About 4-carbamimidoylbenzamide;hydrochloride
4-carbamimidoylbenzamide;hydrochloride (PubChem CID 2724293) has the molecular formula C8H10ClN3O
and a molecular weight of 199.64 g/mol. Its IUPAC name is 4-carbamimidoylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | 4-carbamimidoylbenzamide;hydrochloride |
| PubChem CID | 2724293 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 4-carbamimidoylbenzamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C8H9N3O.ClH/c9-7(10)5-1-3-6(4-2-5)8(11)12;/h1-4H,(H3,9,10)(H2,11,12);1H |
| InChIKey | IYIAWOSYBLPUNL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-carbamimidoylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carbamimidoylbenzamide;hydrochloride?
The IUPAC name of 4-carbamimidoylbenzamide;hydrochloride (CID 2724293) is 4-carbamimidoylbenzamide;hydrochloride.
What is the SMILES notation for 4-carbamimidoylbenzamide;hydrochloride?
The canonical SMILES for 4-carbamimidoylbenzamide;hydrochloride is Cl.[H]/N=C(\N)c1ccc(C(N)=O)cc1.
What is the InChIKey of 4-carbamimidoylbenzamide;hydrochloride?
The InChIKey is IYIAWOSYBLPUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O.ClH/c9-7(10)5-1-3-6(4-2-5)8(11)12;/h1-4H,(H3,9,10)(H2,11,12);1H.
What are the key properties of 4-carbamimidoylbenzamide;hydrochloride?
4-carbamimidoylbenzamide;hydrochloride has a molecular weight of 199.64 g/mol, XLogP of 0.49, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carbamimidoylbenzamide;hydrochloride is sourced from PubChem (CID 2724293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).