C11H20IN2O2 — CID 2724305
4-(2-Iodoacetamido)-2,2,6,6-tetramethylpiperidine-1-oxyl (PubChem CID 2724305) has the molecular formula C11H20IN2O2 and a molecular weight of 339.20 g/mol.
| Compound Name | 4-(2-Iodoacetamido)-2,2,6,6-tetramethylpiperidine-1-oxyl |
|---|---|
| PubChem CID | 2724305 |
| Molecular Formula | C11H20IN2O2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)CI)CC(C)(C)N1[O] |
| InChI | InChI=1S/C11H20IN2O2/c1-10(2)5-8(13-9(15)7-12)6-11(3,4)14(10)16/h8H,5-7H2,1-4H3,(H,13,15) |
| InChIKey | UCTVRHAKQRFPEZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|