About (2R)-butan-2-amine
(2R)-butan-2-amine (PubChem CID 2724537) has the molecular formula C4H11N
and a molecular weight of 73.14 g/mol. Its IUPAC name is (2R)-butan-2-amine.
Molecular Properties
| Compound Name | (2R)-butan-2-amine |
| PubChem CID | 2724537 |
| Molecular Formula | C4H11N |
| Molecular Weight | 73.14 g/mol |
| Exact Mass | 73.09 |
| IUPAC Name | (2R)-butan-2-amine |
| SMILES | CC[C@@H](C)N |
| InChI | InChI=1S/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3/t4-/m1/s1 |
| InChIKey | BHRZNVHARXXAHW-SCSAIBSYSA-N |
| XLogP | 0.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-butan-2-amine?
The IUPAC name of (2R)-butan-2-amine (CID 2724537) is (2R)-butan-2-amine.
What is the SMILES notation for (2R)-butan-2-amine?
The canonical SMILES for (2R)-butan-2-amine is CC[C@@H](C)N.
What is the InChIKey of (2R)-butan-2-amine?
The InChIKey is BHRZNVHARXXAHW-SCSAIBSYSA-N. The full InChI is InChI=1S/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3/t4-/m1/s1.
What are the key properties of (2R)-butan-2-amine?
(2R)-butan-2-amine has a molecular weight of 73.14 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-butan-2-amine is sourced from PubChem (CID 2724537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).