C7H3Br4NO3 — CID 2724547
2,3,5,6-tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one (PubChem CID 2724547) has the molecular formula C7H3Br4NO3 and a molecular weight of 468.72 g/mol. Its IUPAC name is 2,3,5,6-tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one.
| Compound Name | 2,3,5,6-tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 2724547 |
| Molecular Formula | C7H3Br4NO3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 464.68 |
| IUPAC Name | 2,3,5,6-tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one |
| SMILES | CC1([N+](=O)[O-])C(Br)=C(Br)C(=O)C(Br)=C1Br |
| InChI | InChI=1S/C7H3Br4NO3/c1-7(12(14)15)5(10)2(8)4(13)3(9)6(7)11/h1H3 |
| InChIKey | KKWDBDVGMIDKLP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|