C6H12O6 — CID 2724552
(2S,3S,4S,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 2724552) has the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 2724552 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2S,3S,4S,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@]1(O)OC[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4+,5+,6+/m1/s1 |
| InChIKey | LKDRXBCSQODPBY-VANKVMQKSA-N |
| XLogP | -3.22 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |