C10H8ClF3O2 — CID 2724611
(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride (PubChem CID 2724611) has the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride.
| Compound Name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
|---|---|
| PubChem CID | 2724611 |
| Molecular Formula | C10H8ClF3O2 |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| SMILES | CO[C@@](C(=O)Cl)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H8ClF3O2/c1-16-9(8(11)15,10(12,13)14)7-5-3-2-4-6-7/h2-6H,1H3/t9-/m1/s1 |
| InChIKey | PAORVUMOXXAMPL-SECBINFHSA-N |
| XLogP | 2.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|