About (1R)-1-phenylethane-1,2-diol
(1R)-1-phenylethane-1,2-diol (PubChem CID 2724621) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is (1R)-1-phenylethane-1,2-diol.
Molecular Properties
| Compound Name | (1R)-1-phenylethane-1,2-diol |
| PubChem CID | 2724621 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (1R)-1-phenylethane-1,2-diol |
| SMILES | OC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H10O2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8-10H,6H2/t8-/m0/s1 |
| InChIKey | PWMWNFMRSKOCEY-QMMMGPOBSA-N |
| XLogP | 0.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-phenylethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-phenylethane-1,2-diol?
The IUPAC name of (1R)-1-phenylethane-1,2-diol (CID 2724621) is (1R)-1-phenylethane-1,2-diol.
What is the SMILES notation for (1R)-1-phenylethane-1,2-diol?
The canonical SMILES for (1R)-1-phenylethane-1,2-diol is OC[C@H](O)c1ccccc1.
What is the InChIKey of (1R)-1-phenylethane-1,2-diol?
The InChIKey is PWMWNFMRSKOCEY-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H10O2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8-10H,6H2/t8-/m0/s1.
What are the key properties of (1R)-1-phenylethane-1,2-diol?
(1R)-1-phenylethane-1,2-diol has a molecular weight of 138.17 g/mol, XLogP of 0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-phenylethane-1,2-diol is sourced from PubChem (CID 2724621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).