About (4-oxoazetidin-2-yl) benzoate
(4-oxoazetidin-2-yl) benzoate (PubChem CID 2724624) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is (4-oxoazetidin-2-yl) benzoate.
Molecular Properties
| Compound Name | (4-oxoazetidin-2-yl) benzoate |
| PubChem CID | 2724624 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (4-oxoazetidin-2-yl) benzoate |
| SMILES | O=C1CC(OC(=O)c2ccccc2)N1 |
| InChI | InChI=1S/C10H9NO3/c12-8-6-9(11-8)14-10(13)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,11,12) |
| InChIKey | HJJGOOONOIFDRH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-oxoazetidin-2-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxoazetidin-2-yl) benzoate?
The IUPAC name of (4-oxoazetidin-2-yl) benzoate (CID 2724624) is (4-oxoazetidin-2-yl) benzoate.
What is the SMILES notation for (4-oxoazetidin-2-yl) benzoate?
The canonical SMILES for (4-oxoazetidin-2-yl) benzoate is O=C1CC(OC(=O)c2ccccc2)N1.
What is the InChIKey of (4-oxoazetidin-2-yl) benzoate?
The InChIKey is HJJGOOONOIFDRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c12-8-6-9(11-8)14-10(13)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,11,12).
What are the key properties of (4-oxoazetidin-2-yl) benzoate?
(4-oxoazetidin-2-yl) benzoate has a molecular weight of 191.19 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxoazetidin-2-yl) benzoate is sourced from PubChem (CID 2724624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).