About 9H-fluoren-9-amine;hydrochloride
9H-fluoren-9-amine;hydrochloride (PubChem CID 2724685) has the molecular formula C13H12ClN
and a molecular weight of 217.70 g/mol. Its IUPAC name is 9H-fluoren-9-amine;hydrochloride.
Molecular Properties
| Compound Name | 9H-fluoren-9-amine;hydrochloride |
| PubChem CID | 2724685 |
| Molecular Formula | C13H12ClN |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 9H-fluoren-9-amine;hydrochloride |
| SMILES | Cl.NC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C13H11N.ClH/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;/h1-8,13H,14H2;1H |
| InChIKey | SYKJOJSYQSVNOM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-fluoren-9-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-amine;hydrochloride?
The IUPAC name of 9H-fluoren-9-amine;hydrochloride (CID 2724685) is 9H-fluoren-9-amine;hydrochloride.
What is the SMILES notation for 9H-fluoren-9-amine;hydrochloride?
The canonical SMILES for 9H-fluoren-9-amine;hydrochloride is Cl.NC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-amine;hydrochloride?
The InChIKey is SYKJOJSYQSVNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N.ClH/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;/h1-8,13H,14H2;1H.
What are the key properties of 9H-fluoren-9-amine;hydrochloride?
9H-fluoren-9-amine;hydrochloride has a molecular weight of 217.70 g/mol, XLogP of 3.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-amine;hydrochloride is sourced from PubChem (CID 2724685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).