C21H21ClF3N5O4 — CID 27246868
2-[4-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]piperazin-1-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 27246868) has the molecular formula C21H21ClF3N5O4 and a molecular weight of 499.88 g/mol. Its IUPAC name is 2-[4-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]piperazin-1-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[4-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]piperazin-1-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 27246868 |
| Molecular Formula | C21H21ClF3N5O4 |
| Molecular Weight | 499.88 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-[4-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]piperazin-1-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCN(CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CC1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21ClF3N5O4/c22-18-6-3-15(11-17(18)21(23,24)25)27-20(32)13-29-9-7-28(8-10-29)12-19(31)26-14-1-4-16(5-2-14)30(33)34/h1-6,11H,7-10,12-13H2,(H,26,31)(H,27,32) |
| InChIKey | ZHXBAILYTSYYBT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|