C20H23BrO6 — CID 2724769
11-bromo-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene (PubChem CID 2724769) has the molecular formula C20H23BrO6 and a molecular weight of 439.30 g/mol. Its IUPAC name is 11-bromo-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene.
| Compound Name | 11-bromo-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene |
|---|---|
| PubChem CID | 2724769 |
| Molecular Formula | C20H23BrO6 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 11-bromo-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene |
| SMILES | Brc1ccc2c(c1)OCCOCCOc1ccccc1OCCOCCO2 |
| InChI | InChI=1S/C20H23BrO6/c21-16-5-6-19-20(15-16)27-14-10-23-8-12-25-18-4-2-1-3-17(18)24-11-7-22-9-13-26-19/h1-6,15H,7-14H2 |
| InChIKey | SDMPHKFSDSMFIL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |