About [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate
[(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 2724793) has the molecular formula C12H14O5S
and a molecular weight of 270.31 g/mol. Its IUPAC name is [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 2724793 |
| Molecular Formula | C12H14O5S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CCC(=O)O2)cc1 |
| InChI | InChI=1S/C12H14O5S/c1-9-2-5-11(6-3-9)18(14,15)16-8-10-4-7-12(13)17-10/h2-3,5-6,10H,4,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | MGAXYKDBRBNWKT-JTQLQIEISA-N |
| XLogP | 1.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate (CID 2724793) is [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC[C@@H]2CCC(=O)O2)cc1.
What is the InChIKey of [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is MGAXYKDBRBNWKT-JTQLQIEISA-N. The full InChI is InChI=1S/C12H14O5S/c1-9-2-5-11(6-3-9)18(14,15)16-8-10-4-7-12(13)17-10/h2-3,5-6,10H,4,7-8H2,1H3/t10-/m0/s1.
What are the key properties of [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
[(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 270.31 g/mol, XLogP of 1.41, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 2724793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).