C14H19BrO5 — CID 2724799
17-bromo-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene (PubChem CID 2724799) has the molecular formula C14H19BrO5 and a molecular weight of 347.21 g/mol. Its IUPAC name is 17-bromo-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene.
| Compound Name | 17-bromo-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
|---|---|
| PubChem CID | 2724799 |
| Molecular Formula | C14H19BrO5 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 17-bromo-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
| SMILES | Brc1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C14H19BrO5/c15-12-1-2-13-14(11-12)20-10-8-18-6-4-16-3-5-17-7-9-19-13/h1-2,11H,3-10H2 |
| InChIKey | GPKJNSIFVWMEEI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |