C17H24O8 — CID 2724805
2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carboxylic acid (PubChem CID 2724805) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carboxylic acid.
| Compound Name | 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carboxylic acid |
|---|---|
| PubChem CID | 2724805 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)OCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C17H24O8/c18-17(19)14-1-2-15-16(13-14)25-12-10-23-8-6-21-4-3-20-5-7-22-9-11-24-15/h1-2,13H,3-12H2,(H,18,19) |
| InChIKey | GFQYJVLOPVAPGJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |