C16H30O6 — CID 2724842
2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosane (PubChem CID 2724842) has the molecular formula C16H30O6 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosane.
| Compound Name | 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosane |
|---|---|
| PubChem CID | 2724842 |
| Molecular Formula | C16H30O6 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosane |
| SMILES | C1CCC2OCCOCCOCCOCCOCCOC2C1 |
| InChI | InChI=1S/C16H30O6/c1-2-4-16-15(3-1)21-13-11-19-9-7-17-5-6-18-8-10-20-12-14-22-16/h15-16H,1-14H2 |
| InChIKey | OOTXYRWENZEKDS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |