About 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane
2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane (PubChem CID 2724852) has the molecular formula C3H2F6O
and a molecular weight of 170.05 g/mol. Its IUPAC name is 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane.
Analyze 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane?
The IUPAC name of 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane (CID 2724852) is 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane.
What is the SMILES notation for 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane?
The canonical SMILES for 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane is [2H]OC([2H])(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane?
The InChIKey is BYEAHWXPCBROCE-AWPANEGFSA-N. The full InChI is InChI=1S/C3H2F6O/c4-2(5,6)1(10)3(7,8)9/h1,10H/i1D,10D.
What are the key properties of 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane?
2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane has a molecular weight of 170.05 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterio-2-deuteriooxy-1,1,1,3,3,3-hexafluoropropane is sourced from PubChem (CID 2724852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).