C27H34BrO2P — CID 2724935
3,3-di(propan-2-yloxy)propyl-triphenylphosphanium bromide (PubChem CID 2724935) has the molecular formula C27H34BrO2P and a molecular weight of 501.45 g/mol. Its IUPAC name is 3,3-di(propan-2-yloxy)propyl-triphenylphosphanium bromide.
| Compound Name | 3,3-di(propan-2-yloxy)propyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 2724935 |
| Molecular Formula | C27H34BrO2P |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 3,3-di(propan-2-yloxy)propyl-triphenylphosphanium bromide |
| SMILES | CC(C)OC(CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OC(C)C.[Br-] |
| InChI | InChI=1S/C27H34O2P.BrH/c1-22(2)28-27(29-23(3)4)20-21-30(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26;/h5-19,22-23,27H,20-21H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | AAVVGPXJZLGGPO-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|