About 1H-pyrrole-2,5-dicarbaldehyde
1H-pyrrole-2,5-dicarbaldehyde (PubChem CID 2724957) has the molecular formula C6H5NO2
and a molecular weight of 123.11 g/mol. Its IUPAC name is 1H-pyrrole-2,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 1H-pyrrole-2,5-dicarbaldehyde |
| PubChem CID | 2724957 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | 1H-pyrrole-2,5-dicarbaldehyde |
| SMILES | O=Cc1ccc(C=O)[nH]1 |
| InChI | InChI=1S/C6H5NO2/c8-3-5-1-2-6(4-9)7-5/h1-4,7H |
| InChIKey | MKVBQBLIGAFRIY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrole-2,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-2,5-dicarbaldehyde?
The IUPAC name of 1H-pyrrole-2,5-dicarbaldehyde (CID 2724957) is 1H-pyrrole-2,5-dicarbaldehyde.
What is the SMILES notation for 1H-pyrrole-2,5-dicarbaldehyde?
The canonical SMILES for 1H-pyrrole-2,5-dicarbaldehyde is O=Cc1ccc(C=O)[nH]1.
What is the InChIKey of 1H-pyrrole-2,5-dicarbaldehyde?
The InChIKey is MKVBQBLIGAFRIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2/c8-3-5-1-2-6(4-9)7-5/h1-4,7H.
What are the key properties of 1H-pyrrole-2,5-dicarbaldehyde?
1H-pyrrole-2,5-dicarbaldehyde has a molecular weight of 123.11 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-2,5-dicarbaldehyde is sourced from PubChem (CID 2724957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).