C19H21ClN2O4 — CID 27250238
methyl 4-[[2-[2-(4-chlorophenoxy)ethyl-methylamino]acetyl]amino]benzoate (PubChem CID 27250238) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is methyl 4-[[2-[2-(4-chlorophenoxy)ethyl-methylamino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-(4-chlorophenoxy)ethyl-methylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 27250238 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | methyl 4-[[2-[2-(4-chlorophenoxy)ethyl-methylamino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN(C)CCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H21ClN2O4/c1-22(11-12-26-17-9-5-15(20)6-10-17)13-18(23)21-16-7-3-14(4-8-16)19(24)25-2/h3-10H,11-13H2,1-2H3,(H,21,23) |
| InChIKey | ROTKHMCQMLEZQI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |