C7H13NO2S — CID 2725071
(4S)-2,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 2725071) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is (4S)-2,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4S)-2,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 2725071 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (4S)-2,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C7H13NO2S/c1-4-8-5(6(9)10)7(2,3)11-4/h4-5,8H,1-3H3,(H,9,10)/t4?,5-/m0/s1 |
| InChIKey | MQQSPQRNCBFBSG-AKGZTFGVSA-N |
| XLogP | 0.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |