About 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one
2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one (PubChem CID 2725171) has the molecular formula C14H15Cl2N3O2S
and a molecular weight of 360.27 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one |
| PubChem CID | 2725171 |
| Molecular Formula | C14H15Cl2N3O2S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)CSC1=NN=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2N3O2S/c1-21-6-2-5-19-13(20)9-22-14(19)18-17-8-10-3-4-11(15)12(16)7-10/h3-4,7-8H,2,5-6,9H2,1H3 |
| InChIKey | JBJNRURCRLHJID-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one (CID 2725171) is 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one is COCCCN1C(=O)CSC1=NN=Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one?
The InChIKey is JBJNRURCRLHJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N3O2S/c1-21-6-2-5-19-13(20)9-22-14(19)18-17-8-10-3-4-11(15)12(16)7-10/h3-4,7-8H,2,5-6,9H2,1H3.
What are the key properties of 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one?
2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one has a molecular weight of 360.27 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichlorophenyl)methylidenehydrazinylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 2725171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).