C21H22N2O3 — CID 27252931
N-(2,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 27252931) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 27252931 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3[nH]c4c(c3c2)CCCC4)c(OC)c1 |
| InChI | InChI=1S/C21H22N2O3/c1-25-14-8-10-19(20(12-14)26-2)23-21(24)13-7-9-18-16(11-13)15-5-3-4-6-17(15)22-18/h7-12,22H,3-6H2,1-2H3,(H,23,24) |
| InChIKey | NMZRIGWRVJKOCH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|