About N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide
N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide (PubChem CID 2725563) has the molecular formula C8H4BrCl4NO
and a molecular weight of 351.84 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide.
Molecular Properties
| Compound Name | N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide |
| PubChem CID | 2725563 |
| Molecular Formula | C8H4BrCl4NO |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 348.82 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide |
| SMILES | O=C(Nc1ccc(Br)cc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H4BrCl4NO/c9-4-1-2-6(5(10)3-4)14-7(15)8(11,12)13/h1-3H,(H,14,15) |
| InChIKey | VVXMPXQGTZFFQU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide?
The IUPAC name of N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide (CID 2725563) is N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide.
What is the SMILES notation for N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide?
The canonical SMILES for N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide is O=C(Nc1ccc(Br)cc1Cl)C(Cl)(Cl)Cl.
What is the InChIKey of N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide?
The InChIKey is VVXMPXQGTZFFQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrCl4NO/c9-4-1-2-6(5(10)3-4)14-7(15)8(11,12)13/h1-3H,(H,14,15).
What are the key properties of N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide?
N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide has a molecular weight of 351.84 g/mol, XLogP of 4.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2-chlorophenyl)-2,2,2-trichloroacetamide is sourced from PubChem (CID 2725563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).