About 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide
2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide (PubChem CID 2725618) has the molecular formula C17H17Cl2NO2
and a molecular weight of 338.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide |
| PubChem CID | 2725618 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)C(C)Oc2ccc(Cl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H17Cl2NO2/c1-10-4-6-15(11(2)8-10)20-17(21)12(3)22-16-7-5-13(18)9-14(16)19/h4-9,12H,1-3H3,(H,20,21) |
| InChIKey | QWPPGUDQKGAOFE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide?
The IUPAC name of 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide (CID 2725618) is 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide.
What is the SMILES notation for 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide?
The canonical SMILES for 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide is Cc1ccc(NC(=O)C(C)Oc2ccc(Cl)cc2Cl)c(C)c1.
What is the InChIKey of 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide?
The InChIKey is QWPPGUDQKGAOFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl2NO2/c1-10-4-6-15(11(2)8-10)20-17(21)12(3)22-16-7-5-13(18)9-14(16)19/h4-9,12H,1-3H3,(H,20,21).
What are the key properties of 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide?
2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide has a molecular weight of 338.23 g/mol, XLogP of 5.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenoxy)-N-(2,4-dimethylphenyl)propanamide is sourced from PubChem (CID 2725618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).