C11H12N2O — CID 2725675
4-benzyl-3-methyl-1,4-dihydropyrazol-5-one (PubChem CID 2725675) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-benzyl-3-methyl-1,4-dihydropyrazol-5-one.
| Compound Name | 4-benzyl-3-methyl-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 2725675 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-benzyl-3-methyl-1,4-dihydropyrazol-5-one |
| SMILES | CC1=NNC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C11H12N2O/c1-8-10(11(14)13-12-8)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,13,14) |
| InChIKey | GHYQEUSBJOLBDF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |