About N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide
N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide (PubChem CID 2725761) has the molecular formula C19H18ClNO2
and a molecular weight of 327.81 g/mol. Its IUPAC name is N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide |
| PubChem CID | 2725761 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(-c2cc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C19H18ClNO2/c1-19(2,3)18(22)21-15-7-4-12(5-8-15)17-11-13-10-14(20)6-9-16(13)23-17/h4-11H,1-3H3,(H,21,22) |
| InChIKey | NJJUBYPRVCRYMJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide (CID 2725761) is N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1ccc(-c2cc3cc(Cl)ccc3o2)cc1.
What is the InChIKey of N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide?
The InChIKey is NJJUBYPRVCRYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNO2/c1-19(2,3)18(22)21-15-7-4-12(5-8-15)17-11-13-10-14(20)6-9-16(13)23-17/h4-11H,1-3H3,(H,21,22).
What are the key properties of N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide?
N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide has a molecular weight of 327.81 g/mol, XLogP of 5.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(5-chloro-1-benzofuran-2-yl)phenyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 2725761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).