C18H17NO2S2 — CID 2725888
6-(3,4-dimethoxyphenyl)-4-phenyl-3,6-dihydro-1,3-thiazine-2-thione (PubChem CID 2725888) has the molecular formula C18H17NO2S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-phenyl-3,6-dihydro-1,3-thiazine-2-thione.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-phenyl-3,6-dihydro-1,3-thiazine-2-thione |
|---|---|
| PubChem CID | 2725888 |
| Molecular Formula | C18H17NO2S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-phenyl-3,6-dihydro-1,3-thiazine-2-thione |
| SMILES | COc1ccc(C2C=C(c3ccccc3)NC(=S)S2)cc1OC |
| InChI | InChI=1S/C18H17NO2S2/c1-20-15-9-8-13(10-16(15)21-2)17-11-14(19-18(22)23-17)12-6-4-3-5-7-12/h3-11,17H,1-2H3,(H,19,22) |
| InChIKey | TVDAYNHRZNFXFK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_carbam_ene(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|