C13H15F3N6 — CID 2726000
6-methyl-4-N-[2-[[6-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrimidine-2,4-diamine (PubChem CID 2726000) has the molecular formula C13H15F3N6 and a molecular weight of 312.30 g/mol. Its IUPAC name is 6-methyl-4-N-[2-[[6-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-[2-[[6-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 2726000 |
| Molecular Formula | C13H15F3N6 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 6-methyl-4-N-[2-[[6-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(NCCNc2cccc(C(F)(F)F)n2)nc(N)n1 |
| InChI | InChI=1S/C13H15F3N6/c1-8-7-11(22-12(17)20-8)19-6-5-18-10-4-2-3-9(21-10)13(14,15)16/h2-4,7H,5-6H2,1H3,(H,18,21)(H3,17,19,20,22) |
| InChIKey | VOHOPBSRIRLLCX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|