About 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid
2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid (PubChem CID 2726040) has the molecular formula C25H17NO4
and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid |
| PubChem CID | 2726040 |
| Molecular Formula | C25H17NO4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid |
| SMILES | Cc1cc(C)c2c(=O)c(-c3cc(C(=O)O)c4cc5ccccc5cc4n3)coc2c1 |
| InChI | InChI=1S/C25H17NO4/c1-13-7-14(2)23-22(8-13)30-12-19(24(23)27)21-11-18(25(28)29)17-9-15-5-3-4-6-16(15)10-20(17)26-21/h3-12H,1-2H3,(H,28,29) |
| InChIKey | CQOFVNUDNWPMGG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid?
The IUPAC name of 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid (CID 2726040) is 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid.
What is the SMILES notation for 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid?
The canonical SMILES for 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid is Cc1cc(C)c2c(=O)c(-c3cc(C(=O)O)c4cc5ccccc5cc4n3)coc2c1.
What is the InChIKey of 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid?
The InChIKey is CQOFVNUDNWPMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17NO4/c1-13-7-14(2)23-22(8-13)30-12-19(24(23)27)21-11-18(25(28)29)17-9-15-5-3-4-6-16(15)10-20(17)26-21/h3-12H,1-2H3,(H,28,29).
What are the key properties of 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid?
2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid has a molecular weight of 395.41 g/mol, XLogP of 5.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,7-dimethyl-4-oxochromen-3-yl)benzo[g]quinoline-4-carboxylic acid is sourced from PubChem (CID 2726040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).