About 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide
2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 2726122) has the molecular formula C11H9N3O3S
and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 2726122 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1nccs1 |
| InChI | InChI=1S/C11H9N3O3S/c15-10(13-11-12-5-6-18-11)7-8-1-3-9(4-2-8)14(16)17/h1-6H,7H2,(H,12,13,15) |
| InChIKey | ZJHNYEVHAYKTAV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide (CID 2726122) is 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide is O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1nccs1.
What is the InChIKey of 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is ZJHNYEVHAYKTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O3S/c15-10(13-11-12-5-6-18-11)7-8-1-3-9(4-2-8)14(16)17/h1-6H,7H2,(H,12,13,15).
What are the key properties of 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide?
2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 263.28 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 2726122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).