C17H16ClN5O3 — CID 27261436
5-amino-1-(3-chlorophenyl)-N-(2,5-dimethoxyphenyl)triazole-4-carboxamide (PubChem CID 27261436) has the molecular formula C17H16ClN5O3 and a molecular weight of 373.80 g/mol. Its IUPAC name is 5-amino-1-(3-chlorophenyl)-N-(2,5-dimethoxyphenyl)triazole-4-carboxamide.
| Compound Name | 5-amino-1-(3-chlorophenyl)-N-(2,5-dimethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 27261436 |
| Molecular Formula | C17H16ClN5O3 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 5-amino-1-(3-chlorophenyl)-N-(2,5-dimethoxyphenyl)triazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2nnn(-c3cccc(Cl)c3)c2N)c1 |
| InChI | InChI=1S/C17H16ClN5O3/c1-25-12-6-7-14(26-2)13(9-12)20-17(24)15-16(19)23(22-21-15)11-5-3-4-10(18)8-11/h3-9H,19H2,1-2H3,(H,20,24) |
| InChIKey | WYJXHIMECDIRJO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |