About (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate
(4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate (PubChem CID 2726160) has the molecular formula C11H14ClNOS2
and a molecular weight of 275.83 g/mol. Its IUPAC name is (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate.
Molecular Properties
| Compound Name | (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate |
| PubChem CID | 2726160 |
| Molecular Formula | C11H14ClNOS2 |
| Molecular Weight | 275.83 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate |
| SMILES | COCCCNC(=S)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClNOS2/c1-14-8-2-7-13-11(15)16-10-5-3-9(12)4-6-10/h3-6H,2,7-8H2,1H3,(H,13,15) |
| InChIKey | ZMQHFKSOAVKDBF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate?
The IUPAC name of (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate (CID 2726160) is (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate.
What is the SMILES notation for (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate?
The canonical SMILES for (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate is COCCCNC(=S)Sc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate?
The InChIKey is ZMQHFKSOAVKDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNOS2/c1-14-8-2-7-13-11(15)16-10-5-3-9(12)4-6-10/h3-6H,2,7-8H2,1H3,(H,13,15).
What are the key properties of (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate?
(4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate has a molecular weight of 275.83 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) N-(3-methoxypropyl)carbamodithioate is sourced from PubChem (CID 2726160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).