About 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile
2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile (PubChem CID 2726174) has the molecular formula C14H11N3O4S
and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile |
| PubChem CID | 2726174 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile |
| SMILES | Cc1nc(S(=O)(=O)c2ccccc2)c(C#N)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11N3O4S/c1-9-12(8-15)14(16-10(2)13(9)17(18)19)22(20,21)11-6-4-3-5-7-11/h3-7H,1-2H3 |
| InChIKey | JLRPBEAXLCQKGS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 113.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile?
The IUPAC name of 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile (CID 2726174) is 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile.
What is the SMILES notation for 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile?
The canonical SMILES for 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile is Cc1nc(S(=O)(=O)c2ccccc2)c(C#N)c(C)c1[N+](=O)[O-].
What is the InChIKey of 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile?
The InChIKey is JLRPBEAXLCQKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O4S/c1-9-12(8-15)14(16-10(2)13(9)17(18)19)22(20,21)11-6-4-3-5-7-11/h3-7H,1-2H3.
What are the key properties of 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile?
2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile has a molecular weight of 317.33 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-4,6-dimethyl-5-nitropyridine-3-carbonitrile is sourced from PubChem (CID 2726174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).