C16H12F3N5O — CID 27262208
5-amino-1-phenyl-N-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide (PubChem CID 27262208) has the molecular formula C16H12F3N5O and a molecular weight of 347.30 g/mol. Its IUPAC name is 5-amino-1-phenyl-N-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide.
| Compound Name | 5-amino-1-phenyl-N-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 27262208 |
| Molecular Formula | C16H12F3N5O |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 5-amino-1-phenyl-N-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide |
| SMILES | Nc1c(C(=O)Nc2cccc(C(F)(F)F)c2)nnn1-c1ccccc1 |
| InChI | InChI=1S/C16H12F3N5O/c17-16(18,19)10-5-4-6-11(9-10)21-15(25)13-14(20)24(23-22-13)12-7-2-1-3-8-12/h1-9H,20H2,(H,21,25) |
| InChIKey | WFBASYSMPOAADK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |