About (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate
(6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate (PubChem CID 2726329) has the molecular formula C11H11ClN2O3
and a molecular weight of 254.67 g/mol. Its IUPAC name is (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate |
| PubChem CID | 2726329 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)Oc1noc2cc(Cl)ccc12 |
| InChI | InChI=1S/C11H11ClN2O3/c1-6(2)13-11(15)16-10-8-4-3-7(12)5-9(8)17-14-10/h3-6H,1-2H3,(H,13,15) |
| InChIKey | DWNMSIHBCUSMFP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate?
The IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate (CID 2726329) is (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate.
What is the SMILES notation for (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate?
The canonical SMILES for (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate is CC(C)NC(=O)Oc1noc2cc(Cl)ccc12.
What is the InChIKey of (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate?
The InChIKey is DWNMSIHBCUSMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2O3/c1-6(2)13-11(15)16-10-8-4-3-7(12)5-9(8)17-14-10/h3-6H,1-2H3,(H,13,15).
What are the key properties of (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate?
(6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate has a molecular weight of 254.67 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,2-benzoxazol-3-yl) N-propan-2-ylcarbamate is sourced from PubChem (CID 2726329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).