About 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine
3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine (PubChem CID 2726346) has the molecular formula C12H7Cl4N3
and a molecular weight of 335.02 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine.
Molecular Properties
| Compound Name | 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine |
| PubChem CID | 2726346 |
| Molecular Formula | C12H7Cl4N3 |
| Molecular Weight | 335.02 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine |
| SMILES | Clc1cccc(Cl)c1C=NNc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C12H7Cl4N3/c13-8-2-1-3-9(14)7(8)4-18-19-12-10(15)5-17-6-11(12)16/h1-6H,(H,17,19) |
| InChIKey | NRQUAVYOAZGFFD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.02 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine?
The IUPAC name of 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine (CID 2726346) is 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine.
What is the SMILES notation for 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine?
The canonical SMILES for 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine is Clc1cccc(Cl)c1C=NNc1c(Cl)cncc1Cl.
What is the InChIKey of 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine?
The InChIKey is NRQUAVYOAZGFFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl4N3/c13-8-2-1-3-9(14)7(8)4-18-19-12-10(15)5-17-6-11(12)16/h1-6H,(H,17,19).
What are the key properties of 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine?
3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine has a molecular weight of 335.02 g/mol, XLogP of 5.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-[(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine is sourced from PubChem (CID 2726346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).