About [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate
[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 2726646) has the molecular formula C15H16ClNO2S
and a molecular weight of 309.82 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate |
| PubChem CID | 2726646 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C15H16ClNO2S/c1-15(2,3)14(18)19-8-13-17-12(9-20-13)10-4-6-11(16)7-5-10/h4-7,9H,8H2,1-3H3 |
| InChIKey | CZGQAAPRJNKZGS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate?
The IUPAC name of [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate (CID 2726646) is [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate.
What is the SMILES notation for [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate?
The canonical SMILES for [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCc1nc(-c2ccc(Cl)cc2)cs1.
What is the InChIKey of [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate?
The InChIKey is CZGQAAPRJNKZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO2S/c1-15(2,3)14(18)19-8-13-17-12(9-20-13)10-4-6-11(16)7-5-10/h4-7,9H,8H2,1-3H3.
What are the key properties of [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate?
[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate has a molecular weight of 309.82 g/mol, XLogP of 4.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 2726646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).