About N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide
N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 27266587) has the molecular formula C19H18N2O3S
and a molecular weight of 354.43 g/mol. Its IUPAC name is N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide.
Molecular Properties
| Compound Name | N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide |
| PubChem CID | 27266587 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC(=O)N(c1ccccc1C)[C@H]1SC(=O)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C19H18N2O3S/c1-12-8-10-15(11-9-12)21-17(23)18(25-19(21)24)20(14(3)22)16-7-5-4-6-13(16)2/h4-11,18H,1-3H3/t18-/m0/s1 |
| InChIKey | CVQJQMQKLACUIS-SFHVURJKSA-N |
| XLogP | 3.88 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide?
The IUPAC name of N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide (CID 27266587) is N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide.
What is the SMILES notation for N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide?
The canonical SMILES for N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide is CC(=O)N(c1ccccc1C)[C@H]1SC(=O)N(c2ccc(C)cc2)C1=O.
What is the InChIKey of N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide?
The InChIKey is CVQJQMQKLACUIS-SFHVURJKSA-N. The full InChI is InChI=1S/C19H18N2O3S/c1-12-8-10-15(11-9-12)21-17(23)18(25-19(21)24)20(14(3)22)16-7-5-4-6-13(16)2/h4-11,18H,1-3H3/t18-/m0/s1.
What are the key properties of N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide?
N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide has a molecular weight of 354.43 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylphenyl)-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide is sourced from PubChem (CID 27266587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).