C14H20N2O5 — CID 27267040
[(2S)-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]pyrrolidin-2-yl]methanol (PubChem CID 27267040) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is [(2S)-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 27267040 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(2S)-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(CN2CCC[C@H]2CO)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C14H20N2O5/c1-20-13-6-10(8-15-5-3-4-11(15)9-17)12(16(18)19)7-14(13)21-2/h6-7,11,17H,3-5,8-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | OIDTUERXEMTVOY-NSHDSACASA-N |
| XLogP | 1.57 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|