About (2,4-difluorophenyl) N-methylcarbamodithioate
(2,4-difluorophenyl) N-methylcarbamodithioate (PubChem CID 2726807) has the molecular formula C8H7F2NS2
and a molecular weight of 219.28 g/mol. Its IUPAC name is (2,4-difluorophenyl) N-methylcarbamodithioate.
Molecular Properties
| Compound Name | (2,4-difluorophenyl) N-methylcarbamodithioate |
| PubChem CID | 2726807 |
| Molecular Formula | C8H7F2NS2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | (2,4-difluorophenyl) N-methylcarbamodithioate |
| SMILES | CNC(=S)Sc1ccc(F)cc1F |
| InChI | InChI=1S/C8H7F2NS2/c1-11-8(12)13-7-3-2-5(9)4-6(7)10/h2-4H,1H3,(H,11,12) |
| InChIKey | HMXOVJKWKSCWLS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2,4-difluorophenyl) N-methylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-difluorophenyl) N-methylcarbamodithioate?
The IUPAC name of (2,4-difluorophenyl) N-methylcarbamodithioate (CID 2726807) is (2,4-difluorophenyl) N-methylcarbamodithioate.
What is the SMILES notation for (2,4-difluorophenyl) N-methylcarbamodithioate?
The canonical SMILES for (2,4-difluorophenyl) N-methylcarbamodithioate is CNC(=S)Sc1ccc(F)cc1F.
What is the InChIKey of (2,4-difluorophenyl) N-methylcarbamodithioate?
The InChIKey is HMXOVJKWKSCWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NS2/c1-11-8(12)13-7-3-2-5(9)4-6(7)10/h2-4H,1H3,(H,11,12).
What are the key properties of (2,4-difluorophenyl) N-methylcarbamodithioate?
(2,4-difluorophenyl) N-methylcarbamodithioate has a molecular weight of 219.28 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluorophenyl) N-methylcarbamodithioate is sourced from PubChem (CID 2726807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).