C20H23BrN2O2S — CID 27269576
(6R)-1-(4-bromo-3-methylphenyl)-6-(2,4-dihydroxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione (PubChem CID 27269576) has the molecular formula C20H23BrN2O2S and a molecular weight of 435.39 g/mol. Its IUPAC name is (6R)-1-(4-bromo-3-methylphenyl)-6-(2,4-dihydroxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione.
| Compound Name | (6R)-1-(4-bromo-3-methylphenyl)-6-(2,4-dihydroxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 27269576 |
| Molecular Formula | C20H23BrN2O2S |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | (6R)-1-(4-bromo-3-methylphenyl)-6-(2,4-dihydroxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione |
| SMILES | Cc1cc(N2C(=S)NC(C)(C)C[C@]2(C)c2ccc(O)cc2O)ccc1Br |
| InChI | InChI=1S/C20H23BrN2O2S/c1-12-9-13(5-8-16(12)21)23-18(26)22-19(2,3)11-20(23,4)15-7-6-14(24)10-17(15)25/h5-10,24-25H,11H2,1-4H3,(H,22,26)/t20-/m1/s1 |
| InChIKey | NQSSGIRYLZCZDC-HXUWFJFHSA-N |
| XLogP | 4.95 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|