C22H24N6O3S2 — CID 27270099
2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]-N-(thiophen-2-ylmethylcarbamoyl)acetamide (PubChem CID 27270099) has the molecular formula C22H24N6O3S2 and a molecular weight of 484.61 g/mol. Its IUPAC name is 2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]-N-(thiophen-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 27270099 |
| Molecular Formula | C22H24N6O3S2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
| SMILES | CCCCCn1c(=O)c2ccccc2n2c(SCC(=O)NC(=O)NCc3cccs3)nnc12 |
| InChI | InChI=1S/C22H24N6O3S2/c1-2-3-6-11-27-19(30)16-9-4-5-10-17(16)28-21(27)25-26-22(28)33-14-18(29)24-20(31)23-13-15-8-7-12-32-15/h4-5,7-10,12H,2-3,6,11,13-14H2,1H3,(H2,23,24,29,31) |
| InChIKey | YCNACIJNRVLTQC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|