About 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine
6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine (PubChem CID 2727274) has the molecular formula C12H7Cl2F3N2O
and a molecular weight of 323.10 g/mol. Its IUPAC name is 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine |
| PubChem CID | 2727274 |
| Molecular Formula | C12H7Cl2F3N2O |
| Molecular Weight | 323.10 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine |
| SMILES | Nc1cnc(Oc2c(Cl)cccc2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H7Cl2F3N2O/c13-8-2-1-3-9(14)10(8)20-11-7(12(15,16)17)4-6(18)5-19-11/h1-5H,18H2 |
| InChIKey | SHAOBOYFSIBHML-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.10 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine?
The IUPAC name of 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine (CID 2727274) is 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine.
What is the SMILES notation for 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine?
The canonical SMILES for 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine is Nc1cnc(Oc2c(Cl)cccc2Cl)c(C(F)(F)F)c1.
What is the InChIKey of 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine?
The InChIKey is SHAOBOYFSIBHML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl2F3N2O/c13-8-2-1-3-9(14)10(8)20-11-7(12(15,16)17)4-6(18)5-19-11/h1-5H,18H2.
What are the key properties of 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine?
6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine has a molecular weight of 323.10 g/mol, XLogP of 4.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dichlorophenoxy)-5-(trifluoromethyl)pyridin-3-amine is sourced from PubChem (CID 2727274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).