C18H16N4O2S — CID 2727385
2-[(4-methoxyphenyl)methylamino]-1-methyl-6-oxo-4-thiophen-2-ylpyrimidine-5-carbonitrile (PubChem CID 2727385) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylamino]-1-methyl-6-oxo-4-thiophen-2-ylpyrimidine-5-carbonitrile.
| Compound Name | 2-[(4-methoxyphenyl)methylamino]-1-methyl-6-oxo-4-thiophen-2-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 2727385 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylamino]-1-methyl-6-oxo-4-thiophen-2-ylpyrimidine-5-carbonitrile |
| SMILES | COc1ccc(CNc2nc(-c3cccs3)c(C#N)c(=O)n2C)cc1 |
| InChI | InChI=1S/C18H16N4O2S/c1-22-17(23)14(10-19)16(15-4-3-9-25-15)21-18(22)20-11-12-5-7-13(24-2)8-6-12/h3-9H,11H2,1-2H3,(H,20,21) |
| InChIKey | WJVNEYVQHMBYCX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|