About 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one
5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one (PubChem CID 2727457) has the molecular formula C15H10Cl2N2OS
and a molecular weight of 337.23 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one |
| PubChem CID | 2727457 |
| Molecular Formula | C15H10Cl2N2OS |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one |
| SMILES | O=c1[nH]nc(-c2cccs2)cc1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2OS/c16-11-4-3-9(7-12(11)17)6-10-8-13(18-19-15(10)20)14-2-1-5-21-14/h1-5,7-8H,6H2,(H,19,20) |
| InChIKey | HQWJZINUJMPQHB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one?
The IUPAC name of 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one (CID 2727457) is 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one.
What is the SMILES notation for 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one?
The canonical SMILES for 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one is O=c1[nH]nc(-c2cccs2)cc1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one?
The InChIKey is HQWJZINUJMPQHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2N2OS/c16-11-4-3-9(7-12(11)17)6-10-8-13(18-19-15(10)20)14-2-1-5-21-14/h1-5,7-8H,6H2,(H,19,20).
What are the key properties of 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one?
5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one has a molecular weight of 337.23 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dichlorophenyl)methyl]-3-thiophen-2-yl-1H-pyridazin-6-one is sourced from PubChem (CID 2727457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).