About 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone
1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone (PubChem CID 27274720) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone |
| PubChem CID | 27274720 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone |
| SMILES | CC(=O)n1ccc2cc(O)cnc21 |
| InChI | InChI=1S/C9H8N2O2/c1-6(12)11-3-2-7-4-8(13)5-10-9(7)11/h2-5,13H,1H3 |
| InChIKey | PPKXTWKGFGLLEB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone?
The IUPAC name of 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone (CID 27274720) is 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone.
What is the SMILES notation for 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone?
The canonical SMILES for 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone is CC(=O)n1ccc2cc(O)cnc21.
What is the InChIKey of 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone?
The InChIKey is PPKXTWKGFGLLEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-6(12)11-3-2-7-4-8(13)5-10-9(7)11/h2-5,13H,1H3.
What are the key properties of 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone?
1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone has a molecular weight of 176.17 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-hydroxypyrrolo[2,3-b]pyridin-1-yl)ethanone is sourced from PubChem (CID 27274720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).