About ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate
ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate (PubChem CID 2727532) has the molecular formula C10H10N2O2S2
and a molecular weight of 254.34 g/mol. Its IUPAC name is ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate.
Molecular Properties
| Compound Name | ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate |
| PubChem CID | 2727532 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate |
| SMILES | CCOC(=O)CSc1nc2cccnc2s1 |
| InChI | InChI=1S/C10H10N2O2S2/c1-2-14-8(13)6-15-10-12-7-4-3-5-11-9(7)16-10/h3-5H,2,6H2,1H3 |
| InChIKey | SCDRJDCSZVYUCB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate?
The IUPAC name of ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate (CID 2727532) is ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate.
What is the SMILES notation for ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate?
The canonical SMILES for ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate is CCOC(=O)CSc1nc2cccnc2s1.
What is the InChIKey of ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate?
The InChIKey is SCDRJDCSZVYUCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S2/c1-2-14-8(13)6-15-10-12-7-4-3-5-11-9(7)16-10/h3-5H,2,6H2,1H3.
What are the key properties of ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate?
ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate has a molecular weight of 254.34 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetate is sourced from PubChem (CID 2727532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).