C23H26N2O2 — CID 2727672
1,3-bis(6-methyl-3,4-dihydro-2H-quinolin-1-yl)propane-1,3-dione (PubChem CID 2727672) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1,3-bis(6-methyl-3,4-dihydro-2H-quinolin-1-yl)propane-1,3-dione.
| Compound Name | 1,3-bis(6-methyl-3,4-dihydro-2H-quinolin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 2727672 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1,3-bis(6-methyl-3,4-dihydro-2H-quinolin-1-yl)propane-1,3-dione |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)CC(=O)N1CCCc2cc(C)ccc21 |
| InChI | InChI=1S/C23H26N2O2/c1-16-7-9-20-18(13-16)5-3-11-24(20)22(26)15-23(27)25-12-4-6-19-14-17(2)8-10-21(19)25/h7-10,13-14H,3-6,11-12,15H2,1-2H3 |
| InChIKey | BCZMPXSZJHNKOK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|