C29H32N4O5 — CID 27276854
ethyl (3S)-3-(3,4-dimethoxyphenyl)-4-(4-morpholin-4-ylphenyl)-2-phenyl-3H-1,2,4-triazole-5-carboxylate (PubChem CID 27276854) has the molecular formula C29H32N4O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is ethyl (3S)-3-(3,4-dimethoxyphenyl)-4-(4-morpholin-4-ylphenyl)-2-phenyl-3H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl (3S)-3-(3,4-dimethoxyphenyl)-4-(4-morpholin-4-ylphenyl)-2-phenyl-3H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 27276854 |
| Molecular Formula | C29H32N4O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | ethyl (3S)-3-(3,4-dimethoxyphenyl)-4-(4-morpholin-4-ylphenyl)-2-phenyl-3H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)[C@@H](c2ccc(OC)c(OC)c2)N1c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C29H32N4O5/c1-4-38-29(34)27-30-33(24-8-6-5-7-9-24)28(21-10-15-25(35-2)26(20-21)36-3)32(27)23-13-11-22(12-14-23)31-16-18-37-19-17-31/h5-15,20,28H,4,16-19H2,1-3H3/t28-/m0/s1 |
| InChIKey | MOQFLHMPYKFWRL-NDEPHWFRSA-N |
| XLogP | 4.44 |
| TPSA | 76.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|