C21H26F6N2O6 — CID 27276889
diethyl (2S,3R,5R,6R)-4-[4-(dimethylamino)phenyl]-2,6-dihydroxy-2,6-bis(trifluoromethyl)piperidine-3,5-dicarboxylate (PubChem CID 27276889) has the molecular formula C21H26F6N2O6 and a molecular weight of 516.44 g/mol. Its IUPAC name is diethyl (2S,3R,5R,6R)-4-[4-(dimethylamino)phenyl]-2,6-dihydroxy-2,6-bis(trifluoromethyl)piperidine-3,5-dicarboxylate.
| Compound Name | diethyl (2S,3R,5R,6R)-4-[4-(dimethylamino)phenyl]-2,6-dihydroxy-2,6-bis(trifluoromethyl)piperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 27276889 |
| Molecular Formula | C21H26F6N2O6 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | diethyl (2S,3R,5R,6R)-4-[4-(dimethylamino)phenyl]-2,6-dihydroxy-2,6-bis(trifluoromethyl)piperidine-3,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(c2ccc(N(C)C)cc2)[C@@H](C(=O)OCC)[C@](O)(C(F)(F)F)N[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C21H26F6N2O6/c1-5-34-16(30)14-13(11-7-9-12(10-8-11)29(3)4)15(17(31)35-6-2)19(33,21(25,26)27)28-18(14,32)20(22,23)24/h7-10,13-15,28,32-33H,5-6H2,1-4H3/t13?,14-,15-,18-,19+/m0/s1 |
| InChIKey | LCQMJMOTMRIGEZ-RRQMUBCJSA-N |
| XLogP | 2.30 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|